C26H29N2Se+ — CID 11678770
[6-(dimethylamino)-9-(2,4,6-trimethylphenyl)selenoxanthen-3-ylidene]-dimethylazanium (PubChem CID 11678770) has the molecular formula C26H29N2Se+ and a molecular weight of 448.49 g/mol. Its IUPAC name is [6-(dimethylamino)-9-(2,4,6-trimethylphenyl)selenoxanthen-3-ylidene]-dimethylazanium.
| Compound Name | [6-(dimethylamino)-9-(2,4,6-trimethylphenyl)selenoxanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 11678770 |
| Molecular Formula | C26H29N2Se+ |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [6-(dimethylamino)-9-(2,4,6-trimethylphenyl)selenoxanthen-3-ylidene]-dimethylazanium |
| SMILES | Cc1cc(C)c(-c2c3ccc(=[N+](C)C)cc-3[se]c3cc(N(C)C)ccc23)c(C)c1 |
| InChI | InChI=1S/C26H29N2Se/c1-16-12-17(2)25(18(3)13-16)26-21-10-8-19(27(4)5)14-23(21)29-24-15-20(28(6)7)9-11-22(24)26/h8-15H,1-7H3/q+1 |
| InChIKey | KHPLTYZUXIFDEW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|