C27H25F6N2PSe — CID 127044487
[3-(dimethylamino)-12-phenylbenzo[b]selenoxanthen-8-ylidene]-dimethylazanium hexafluorophosphate (PubChem CID 127044487) has the molecular formula C27H25F6N2PSe and a molecular weight of 601.43 g/mol. Its IUPAC name is [3-(dimethylamino)-12-phenylbenzo[b]selenoxanthen-8-ylidene]-dimethylazanium hexafluorophosphate.
| Compound Name | [3-(dimethylamino)-12-phenylbenzo[b]selenoxanthen-8-ylidene]-dimethylazanium hexafluorophosphate |
|---|---|
| PubChem CID | 127044487 |
| Molecular Formula | C27H25F6N2PSe |
| Molecular Weight | 601.43 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | [3-(dimethylamino)-12-phenylbenzo[b]selenoxanthen-8-ylidene]-dimethylazanium hexafluorophosphate |
| SMILES | CN(C)c1ccc2c(-c3ccccc3)c3cc4ccc(=[N+](C)C)cc4cc3[se]c2c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C27H25N2Se.F6P/c1-28(2)21-11-10-19-15-24-25(16-20(19)14-21)30-26-17-22(29(3)4)12-13-23(26)27(24)18-8-6-5-7-9-18;1-7(2,3,4,5)6/h5-17H,1-4H3;/q+1;-1 |
| InChIKey | GWBHXZSYCHBIQG-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.43 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|