C18H21F6N2PSe — CID 11504089
[6-(dimethylamino)-9-methylselenoxanthen-3-ylidene]-dimethylazanium hexafluorophosphate (PubChem CID 11504089) has the molecular formula C18H21F6N2PSe and a molecular weight of 489.30 g/mol. Its IUPAC name is [6-(dimethylamino)-9-methylselenoxanthen-3-ylidene]-dimethylazanium hexafluorophosphate.
| Compound Name | [6-(dimethylamino)-9-methylselenoxanthen-3-ylidene]-dimethylazanium hexafluorophosphate |
|---|---|
| PubChem CID | 11504089 |
| Molecular Formula | C18H21F6N2PSe |
| Molecular Weight | 489.30 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | [6-(dimethylamino)-9-methylselenoxanthen-3-ylidene]-dimethylazanium hexafluorophosphate |
| SMILES | Cc1c2ccc(=[N+](C)C)cc-2[se]c2cc(N(C)C)ccc12.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C18H21N2Se.F6P/c1-12-15-8-6-13(19(2)3)10-17(15)21-18-11-14(20(4)5)7-9-16(12)18;1-7(2,3,4,5)6/h6-11H,1-5H3;/q+1;-1 |
| InChIKey | RKSFIDPPQMWWRE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.30 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|