C20H14FNO3S — CID 53304105
5-fluoro-5-(4-methoxyphenyl)-3-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione (PubChem CID 53304105) has the molecular formula C20H14FNO3S and a molecular weight of 367.40 g/mol. Its IUPAC name is 5-fluoro-5-(4-methoxyphenyl)-3-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione.
| Compound Name | 5-fluoro-5-(4-methoxyphenyl)-3-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 53304105 |
| Molecular Formula | C20H14FNO3S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 5-fluoro-5-(4-methoxyphenyl)-3-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
| SMILES | COc1ccc(C2(F)C(=O)Nc3scc(-c4ccccc4)c3C2=O)cc1 |
| InChI | InChI=1S/C20H14FNO3S/c1-25-14-9-7-13(8-10-14)20(21)17(23)16-15(12-5-3-2-4-6-12)11-26-18(16)22-19(20)24/h2-11H,1H3,(H,22,24) |
| InChIKey | CGCQFVKTXHUCAH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|