C27H36O14S — CID 53304253
[(2R,3R,4S,5S,6S)-3,5-diacetyloxy-4-acetylsulfanyl-6-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-4-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 53304253) has the molecular formula C27H36O14S and a molecular weight of 616.64 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,5-diacetyloxy-4-acetylsulfanyl-6-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-4-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,5-diacetyloxy-4-acetylsulfanyl-6-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-4-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 53304253 |
| Molecular Formula | C27H36O14S |
| Molecular Weight | 616.64 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,5-diacetyloxy-4-acetylsulfanyl-6-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-4-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](OCc3ccccc3)O[C@H](CO)[C@H]2O)[C@H](OC(C)=O)[C@@H](SC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H36O14S/c1-13(29)35-12-19-22(37-14(2)30)25(42-16(4)32)24(38-15(3)31)27(40-19)41-23-20(33)18(10-28)39-26(21(23)34)36-11-17-8-6-5-7-9-17/h5-9,18-28,33-34H,10-12H2,1-4H3/t18-,19-,20-,21-,22-,23+,24-,25+,26-,27+/m1/s1 |
| InChIKey | BJCIGIASBYOYBD-LLBFFYKQSA-N |
| XLogP | -0.17 |
| TPSA | 193.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.64 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|