C49H70N4O15 — CID 53304585
2,4-dipyridin-2-yl-6-[(E)-2-[3,4,5-tris[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]ethenyl]pyrimidine (PubChem CID 53304585) has the molecular formula C49H70N4O15 and a molecular weight of 955.11 g/mol. Its IUPAC name is 2,4-dipyridin-2-yl-6-[(E)-2-[3,4,5-tris[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]ethenyl]pyrimidine.
| Compound Name | 2,4-dipyridin-2-yl-6-[(E)-2-[3,4,5-tris[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]ethenyl]pyrimidine |
|---|---|
| PubChem CID | 53304585 |
| Molecular Formula | C49H70N4O15 |
| Molecular Weight | 955.11 g/mol |
| Exact Mass | 954.48 |
| IUPAC Name | 2,4-dipyridin-2-yl-6-[(E)-2-[3,4,5-tris[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]ethenyl]pyrimidine |
| SMILES | COCCOCCOCCOCCOc1cc(/C=C/c2cc(-c3ccccn3)nc(-c3ccccn3)n2)cc(OCCOCCOCCOCCOC)c1OCCOCCOCCOCCOC |
| InChI | InChI=1S/C49H70N4O15/c1-54-14-17-57-20-23-60-26-29-63-32-35-66-46-38-41(10-11-42-40-45(43-8-4-6-12-50-43)53-49(52-42)44-9-5-7-13-51-44)39-47(67-36-33-64-30-27-61-24-21-58-18-15-55-2)48(46)68-37-34-65-31-28-62-25-22-59-19-16-56-3/h4-13,38-40H,14-37H2,1-3H3/b11-10+ |
| InChIKey | WXRARFNCYHMZON-ZHACJKMWSA-N |
| XLogP | 5.00 |
| TPSA | 190.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.11 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|