C17H22O6S — CID 53305568
[(2S,6R)-2-butoxy-5-oxo-2H-pyran-6-yl]methyl 4-methylbenzenesulfonate (PubChem CID 53305568) has the molecular formula C17H22O6S and a molecular weight of 354.42 g/mol. Its IUPAC name is [(2S,6R)-2-butoxy-5-oxo-2H-pyran-6-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,6R)-2-butoxy-5-oxo-2H-pyran-6-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 53305568 |
| Molecular Formula | C17H22O6S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [(2S,6R)-2-butoxy-5-oxo-2H-pyran-6-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCCCO[C@@H]1C=CC(=O)[C@@H](COS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C17H22O6S/c1-3-4-11-21-17-10-9-15(18)16(23-17)12-22-24(19,20)14-7-5-13(2)6-8-14/h5-10,16-17H,3-4,11-12H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | WHYPKGMPURYXMW-SJORKVTESA-N |
| XLogP | 2.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|