C14H22ClN5 — CID 53308012
2-benzyl-1-cyclopentyl-3-(diaminomethylidene)guanidine;hydrochloride (PubChem CID 53308012) has the molecular formula C14H22ClN5 and a molecular weight of 295.82 g/mol. Its IUPAC name is 2-benzyl-1-cyclopentyl-3-(diaminomethylidene)guanidine;hydrochloride.
| Compound Name | 2-benzyl-1-cyclopentyl-3-(diaminomethylidene)guanidine;hydrochloride |
|---|---|
| PubChem CID | 53308012 |
| Molecular Formula | C14H22ClN5 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-benzyl-1-cyclopentyl-3-(diaminomethylidene)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/C(=N/Cc1ccccc1)NC1CCCC1 |
| InChI | InChI=1S/C14H21N5.ClH/c15-13(16)19-14(18-12-8-4-5-9-12)17-10-11-6-2-1-3-7-11;/h1-3,6-7,12H,4-5,8-10H2,(H5,15,16,17,18,19);1H |
| InChIKey | BSFKPFPHQBMNHO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|