C16H26ClN5 — CID 53307935
1-cyclohexyl-3-(diaminomethylidene)-2-(2-phenylethyl)guanidine;hydrochloride (PubChem CID 53307935) has the molecular formula C16H26ClN5 and a molecular weight of 323.87 g/mol. Its IUPAC name is 1-cyclohexyl-3-(diaminomethylidene)-2-(2-phenylethyl)guanidine;hydrochloride.
| Compound Name | 1-cyclohexyl-3-(diaminomethylidene)-2-(2-phenylethyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 53307935 |
| Molecular Formula | C16H26ClN5 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-cyclohexyl-3-(diaminomethylidene)-2-(2-phenylethyl)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/C(=N\CCc1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C16H25N5.ClH/c17-15(18)21-16(20-14-9-5-2-6-10-14)19-12-11-13-7-3-1-4-8-13;/h1,3-4,7-8,14H,2,5-6,9-12H2,(H5,17,18,19,20,21);1H |
| InChIKey | YOLYAZMWHJZSKA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|