C18H23NO6 — CID 53308579
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[methoxy(naphthalen-1-ylmethyl)amino]oxane-3,4,5-triol (PubChem CID 53308579) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[methoxy(naphthalen-1-ylmethyl)amino]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[methoxy(naphthalen-1-ylmethyl)amino]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53308579 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[methoxy(naphthalen-1-ylmethyl)amino]oxane-3,4,5-triol |
| SMILES | CON(Cc1cccc2ccccc12)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H23NO6/c1-24-19(18-17(23)16(22)15(21)14(10-20)25-18)9-12-7-4-6-11-5-2-3-8-13(11)12/h2-8,14-18,20-23H,9-10H2,1H3/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | BHFMWTQCHHPQMR-UYTYNIKBSA-N |
| XLogP | 0.00 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|