C15H23NO6 — CID 53308585
(2R,3R,4S,5S,6R)-2-[benzyl(ethoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53308585) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[benzyl(ethoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[benzyl(ethoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53308585 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[benzyl(ethoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCON(Cc1ccccc1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H23NO6/c1-2-21-16(8-10-6-4-3-5-7-10)15-14(20)13(19)12(18)11(9-17)22-15/h3-7,11-15,17-20H,2,8-9H2,1H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | PUGJEHIXRYRTFC-UXXRCYHCSA-N |
| XLogP | -0.76 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|