C20H25NO6 — CID 53308584
(2R,3R,4S,5S,6R)-2-[benzhydryl(methoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53308584) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[benzhydryl(methoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[benzhydryl(methoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53308584 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[benzhydryl(methoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CON(C(c1ccccc1)c1ccccc1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H25NO6/c1-26-21(20-19(25)18(24)17(23)15(12-22)27-20)16(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15-20,22-25H,12H2,1H3/t15-,17-,18+,19-,20-/m1/s1 |
| InChIKey | DAEIFWRMMFSFOG-XIKSMUEASA-N |
| XLogP | 0.44 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|