C26H21ClN2O2 — CID 53311468
3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-(3,4-dimethylphenyl)-1-phenylimidazol-2-one (PubChem CID 53311468) has the molecular formula C26H21ClN2O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-(3,4-dimethylphenyl)-1-phenylimidazol-2-one.
| Compound Name | 3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-(3,4-dimethylphenyl)-1-phenylimidazol-2-one |
|---|---|
| PubChem CID | 53311468 |
| Molecular Formula | C26H21ClN2O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-(3,4-dimethylphenyl)-1-phenylimidazol-2-one |
| SMILES | Cc1ccc(-c2cn(-c3ccccc3)c(=O)n2C(=O)/C=C/c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C26H21ClN2O2/c1-18-8-12-21(16-19(18)2)24-17-28(23-6-4-3-5-7-23)26(31)29(24)25(30)15-11-20-9-13-22(27)14-10-20/h3-17H,1-2H3/b15-11+ |
| InChIKey | VIEXNTDNAYAXBY-RVDMUPIBSA-N |
| XLogP | 5.93 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|