C24H18N2O2 — CID 53311379
1,4-diphenyl-3-[(E)-3-phenylprop-2-enoyl]imidazol-2-one (PubChem CID 53311379) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1,4-diphenyl-3-[(E)-3-phenylprop-2-enoyl]imidazol-2-one.
| Compound Name | 1,4-diphenyl-3-[(E)-3-phenylprop-2-enoyl]imidazol-2-one |
|---|---|
| PubChem CID | 53311379 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1,4-diphenyl-3-[(E)-3-phenylprop-2-enoyl]imidazol-2-one |
| SMILES | O=C(/C=C/c1ccccc1)n1c(-c2ccccc2)cn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C24H18N2O2/c27-23(17-16-19-10-4-1-5-11-19)26-22(20-12-6-2-7-13-20)18-25(24(26)28)21-14-8-3-9-15-21/h1-18H/b17-16+ |
| InChIKey | HGJJYFRAPVWESQ-WUKNDPDISA-N |
| XLogP | 4.66 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|