C27H24N2O6 — CID 53311292
4-(3,4-dimethoxyphenyl)-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-1-phenylimidazol-2-one (PubChem CID 53311292) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-1-phenylimidazol-2-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-1-phenylimidazol-2-one |
|---|---|
| PubChem CID | 53311292 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-1-phenylimidazol-2-one |
| SMILES | COc1cc(/C=C/C(=O)n2c(-c3ccc(OC)c(OC)c3)cn(-c3ccccc3)c2=O)ccc1O |
| InChI | InChI=1S/C27H24N2O6/c1-33-23-13-11-19(16-25(23)35-3)21-17-28(20-7-5-4-6-8-20)27(32)29(21)26(31)14-10-18-9-12-22(30)24(15-18)34-2/h4-17,30H,1-3H3/b14-10+ |
| InChIKey | CGXSSOMVSUPILZ-GXDHUFHOSA-N |
| XLogP | 4.39 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|