About (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride
(4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride (PubChem CID 53313725) has the molecular formula C12H17ClN3O3S-
and a molecular weight of 318.81 g/mol. Its IUPAC name is (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride.
Molecular Properties
| Compound Name | (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride |
| PubChem CID | 53313725 |
| Molecular Formula | C12H17ClN3O3S- |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride |
| SMILES | [Cl-].[H]/N=C(\N)SCc1ccc(OCCCC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H17N3O3S.ClH/c1-2-3-6-18-11-5-4-9(8-19-12(13)14)7-10(11)15(16)17;/h4-5,7H,2-3,6,8H2,1H3,(H3,13,14);1H/p-1 |
| InChIKey | ZGHVWJQMZGWRAI-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride?
The IUPAC name of (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride (CID 53313725) is (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride.
What is the SMILES notation for (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride?
The canonical SMILES for (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride is [Cl-].[H]/N=C(\N)SCc1ccc(OCCCC)c([N+](=O)[O-])c1.
What is the InChIKey of (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride?
The InChIKey is ZGHVWJQMZGWRAI-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H17N3O3S.ClH/c1-2-3-6-18-11-5-4-9(8-19-12(13)14)7-10(11)15(16)17;/h4-5,7H,2-3,6,8H2,1H3,(H3,13,14);1H/p-1.
What are the key properties of (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride?
(4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride has a molecular weight of 318.81 g/mol, XLogP of -0.10, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butoxy-3-nitrophenyl)methyl carbamimidothioate chloride is sourced from PubChem (CID 53313725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).