C22H28N2O4 — CID 53317563
[(1R,2R,9S,17S)-5-hydroxy-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] benzoate (PubChem CID 53317563) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is [(1R,2R,9S,17S)-5-hydroxy-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] benzoate.
| Compound Name | [(1R,2R,9S,17S)-5-hydroxy-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] benzoate |
|---|---|
| PubChem CID | 53317563 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(1R,2R,9S,17S)-5-hydroxy-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] benzoate |
| SMILES | O=C(OC1C[C@@H]2[C@H]3CCCN4CCC[C@@H](CN2C(=O)C1O)[C@@H]34)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O4/c25-20-18(28-22(27)14-6-2-1-3-7-14)12-17-16-9-5-11-23-10-4-8-15(19(16)23)13-24(17)21(20)26/h1-3,6-7,15-20,25H,4-5,8-13H2/t15-,16+,17+,18?,19-,20?/m0/s1 |
| InChIKey | CVBBAKBOGDBWKS-AGGMQOJSSA-N |
| XLogP | 1.68 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |