C32H33NO9 — CID 53319424
2-[2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]ethoxy]ethyl (E)-3-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)prop-2-enoate (PubChem CID 53319424) has the molecular formula C32H33NO9 and a molecular weight of 575.61 g/mol. Its IUPAC name is 2-[2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]ethoxy]ethyl (E)-3-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)prop-2-enoate.
| Compound Name | 2-[2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]ethoxy]ethyl (E)-3-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 53319424 |
| Molecular Formula | C32H33NO9 |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 2-[2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]ethoxy]ethyl (E)-3-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)NCCOCCOC(=O)/C=C/c2c(C)oc3c(C)c4oc(=O)cc(C)c4cc23)cc1OC |
| InChI | InChI=1S/C32H33NO9/c1-19-16-30(36)42-31-20(2)32-25(18-24(19)31)23(21(3)41-32)8-11-29(35)40-15-14-39-13-12-33-28(34)10-7-22-6-9-26(37-4)27(17-22)38-5/h6-11,16-18H,12-15H2,1-5H3,(H,33,34)/b10-7+,11-8+ |
| InChIKey | ITOXWFKCFINPJM-AMMQDNIMSA-N |
| XLogP | 4.88 |
| TPSA | 126.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|