C27H26N2O2S — CID 53322796
8-methyl-3-methylsulfinyl-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide (PubChem CID 53322796) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is 8-methyl-3-methylsulfinyl-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide.
| Compound Name | 8-methyl-3-methylsulfinyl-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 53322796 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 8-methyl-3-methylsulfinyl-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide |
| SMILES | CC[C@H](NC(=O)c1c(S(C)=O)c(-c2ccccc2)nc2c(C)cccc12)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O2S/c1-4-22(19-13-7-5-8-14-19)28-27(30)23-21-17-11-12-18(2)24(21)29-25(26(23)32(3)31)20-15-9-6-10-16-20/h5-17,22H,4H2,1-3H3,(H,28,30)/t22-,32?/m0/s1 |
| InChIKey | HKSOZNAIPYOXQZ-LCUARMQBSA-N |
| XLogP | 5.83 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |