C27H25NO — CID 90487509
2-methyl-3-phenyl-N-[(1S)-1-phenylpropyl]naphthalene-1-carboxamide (PubChem CID 90487509) has the molecular formula C27H25NO and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-methyl-3-phenyl-N-[(1S)-1-phenylpropyl]naphthalene-1-carboxamide.
| Compound Name | 2-methyl-3-phenyl-N-[(1S)-1-phenylpropyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 90487509 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-methyl-3-phenyl-N-[(1S)-1-phenylpropyl]naphthalene-1-carboxamide |
| SMILES | CC[C@H](NC(=O)c1c(C)c(-c2ccccc2)cc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C27H25NO/c1-3-25(21-14-8-5-9-15-21)28-27(29)26-19(2)24(20-12-6-4-7-13-20)18-22-16-10-11-17-23(22)26/h4-18,25H,3H2,1-2H3,(H,28,29)/t25-/m0/s1 |
| InChIKey | QOWVTTGWMLRCMK-VWLOTQADSA-N |
| XLogP | 6.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |