C21H21N3O4 — CID 150861130
[3-methyl-1-oxo-4-[[(1S)-1-phenylpropyl]carbamoyl]isoquinolin-2-yl]carbamic acid (PubChem CID 150861130) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is [3-methyl-1-oxo-4-[[(1S)-1-phenylpropyl]carbamoyl]isoquinolin-2-yl]carbamic acid.
| Compound Name | [3-methyl-1-oxo-4-[[(1S)-1-phenylpropyl]carbamoyl]isoquinolin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 150861130 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [3-methyl-1-oxo-4-[[(1S)-1-phenylpropyl]carbamoyl]isoquinolin-2-yl]carbamic acid |
| SMILES | CC[C@H](NC(=O)c1c(C)n(NC(=O)O)c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O4/c1-3-17(14-9-5-4-6-10-14)22-19(25)18-13(2)24(23-21(27)28)20(26)16-12-8-7-11-15(16)18/h4-12,17,23H,3H2,1-2H3,(H,22,25)(H,27,28)/t17-/m0/s1 |
| InChIKey | KSAXLPWHOHGCSI-KRWDZBQOSA-N |
| XLogP | 3.41 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |