C24H29N3O2 — CID 59253017
2-(butylamino)-3-methyl-1-oxo-N-[(1S)-1-phenylpropyl]isoquinoline-4-carboxamide (PubChem CID 59253017) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-(butylamino)-3-methyl-1-oxo-N-[(1S)-1-phenylpropyl]isoquinoline-4-carboxamide.
| Compound Name | 2-(butylamino)-3-methyl-1-oxo-N-[(1S)-1-phenylpropyl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59253017 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-(butylamino)-3-methyl-1-oxo-N-[(1S)-1-phenylpropyl]isoquinoline-4-carboxamide |
| SMILES | CCCCNn1c(C)c(C(=O)N[C@@H](CC)c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H29N3O2/c1-4-6-16-25-27-17(3)22(19-14-10-11-15-20(19)24(27)29)23(28)26-21(5-2)18-12-8-7-9-13-18/h7-15,21,25H,4-6,16H2,1-3H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | SBOIVBKKFXXJKD-NRFANRHFSA-N |
| XLogP | 4.53 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|