C21H21N5O4 — CID 53332467
6-(1,3-benzodioxol-5-yl)-2-[2-(cyclohexen-1-yl)ethylamino]-8H-pyrimido[4,5-d]pyrimidine-5,7-dione (PubChem CID 53332467) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-2-[2-(cyclohexen-1-yl)ethylamino]-8H-pyrimido[4,5-d]pyrimidine-5,7-dione.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-2-[2-(cyclohexen-1-yl)ethylamino]-8H-pyrimido[4,5-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 53332467 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-2-[2-(cyclohexen-1-yl)ethylamino]-8H-pyrimido[4,5-d]pyrimidine-5,7-dione |
| SMILES | O=c1[nH]c2nc(NCCC3=CCCCC3)ncc2c(=O)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21N5O4/c27-19-15-11-23-20(22-9-8-13-4-2-1-3-5-13)24-18(15)25-21(28)26(19)14-6-7-16-17(10-14)30-12-29-16/h4,6-7,10-11H,1-3,5,8-9,12H2,(H2,22,23,24,25,28) |
| InChIKey | JSSPTKYHFDBCQE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|