C20H21FN2O3S — CID 53337308
(Z)-2-(2-fluorophenyl)sulfonyl-3-(4-methylanilino)-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 53337308) has the molecular formula C20H21FN2O3S and a molecular weight of 388.46 g/mol. Its IUPAC name is (Z)-2-(2-fluorophenyl)sulfonyl-3-(4-methylanilino)-1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | (Z)-2-(2-fluorophenyl)sulfonyl-3-(4-methylanilino)-1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 53337308 |
| Molecular Formula | C20H21FN2O3S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (Z)-2-(2-fluorophenyl)sulfonyl-3-(4-methylanilino)-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | Cc1ccc(N/C=C(/C(=O)N2CCCC2)S(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C20H21FN2O3S/c1-15-8-10-16(11-9-15)22-14-19(20(24)23-12-4-5-13-23)27(25,26)18-7-3-2-6-17(18)21/h2-3,6-11,14,22H,4-5,12-13H2,1H3/b19-14- |
| InChIKey | WZGVNMJPRBISCY-RGEXLXHISA-N |
| XLogP | 3.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|