C21H27ClN2O2 — CID 53339319
3-[[5-[[(1R)-1-(4-chloro-3,5-dimethylphenyl)ethyl]amino]-2-methylphenyl]methylamino]propanoic acid (PubChem CID 53339319) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is 3-[[5-[[(1R)-1-(4-chloro-3,5-dimethylphenyl)ethyl]amino]-2-methylphenyl]methylamino]propanoic acid.
| Compound Name | 3-[[5-[[(1R)-1-(4-chloro-3,5-dimethylphenyl)ethyl]amino]-2-methylphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 53339319 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-[[5-[[(1R)-1-(4-chloro-3,5-dimethylphenyl)ethyl]amino]-2-methylphenyl]methylamino]propanoic acid |
| SMILES | Cc1ccc(N[C@H](C)c2cc(C)c(Cl)c(C)c2)cc1CNCCC(=O)O |
| InChI | InChI=1S/C21H27ClN2O2/c1-13-5-6-19(11-18(13)12-23-8-7-20(25)26)24-16(4)17-9-14(2)21(22)15(3)10-17/h5-6,9-11,16,23-24H,7-8,12H2,1-4H3,(H,25,26)/t16-/m1/s1 |
| InChIKey | ZDMSJKNDAJGDOQ-MRXNPFEDSA-N |
| XLogP | 5.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|