C23H27N3O4 — CID 53340544
7-[5-(2,6-dimethylanilino)-1,3-dioxoisoindol-2-yl]-N-hydroxyheptanamide (PubChem CID 53340544) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 7-[5-(2,6-dimethylanilino)-1,3-dioxoisoindol-2-yl]-N-hydroxyheptanamide.
| Compound Name | 7-[5-(2,6-dimethylanilino)-1,3-dioxoisoindol-2-yl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 53340544 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 7-[5-(2,6-dimethylanilino)-1,3-dioxoisoindol-2-yl]-N-hydroxyheptanamide |
| SMILES | Cc1cccc(C)c1Nc1ccc2c(c1)C(=O)N(CCCCCCC(=O)NO)C2=O |
| InChI | InChI=1S/C23H27N3O4/c1-15-8-7-9-16(2)21(15)24-17-11-12-18-19(14-17)23(29)26(22(18)28)13-6-4-3-5-10-20(27)25-30/h7-9,11-12,14,24,30H,3-6,10,13H2,1-2H3,(H,25,27) |
| InChIKey | BMLCYZRQELFHDD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|