C10H11F9N2OS — CID 53343022
(S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide (PubChem CID 53343022) has the molecular formula C10H11F9N2OS and a molecular weight of 378.26 g/mol. Its IUPAC name is (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide.
| Compound Name | (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide |
|---|---|
| PubChem CID | 53343022 |
| Molecular Formula | C10H11F9N2OS |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | (S)-N-[(1R)-1-cyano-2,2-dimethylpropyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide |
| SMILES | CC(C)(C)[C@H](C#N)N[S@@](=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F9N2OS/c1-6(2,3)5(4-20)21-23(22)10(18,19)8(13,14)7(11,12)9(15,16)17/h5,21H,1-3H3/t5-,23-/m0/s1 |
| InChIKey | XSVAEBXDYGBKOT-FLLCUVKXSA-N |
| XLogP | 3.60 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|