C32H42N2O6 — CID 53343603
N-butyl-2-[2-[2-(butylamino)-2-oxoethyl]-4,5-dimethoxyphenyl]-6,7-dimethoxy-4-methylnaphthalene-1-carboxamide (PubChem CID 53343603) has the molecular formula C32H42N2O6 and a molecular weight of 550.70 g/mol. Its IUPAC name is N-butyl-2-[2-[2-(butylamino)-2-oxoethyl]-4,5-dimethoxyphenyl]-6,7-dimethoxy-4-methylnaphthalene-1-carboxamide.
| Compound Name | N-butyl-2-[2-[2-(butylamino)-2-oxoethyl]-4,5-dimethoxyphenyl]-6,7-dimethoxy-4-methylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 53343603 |
| Molecular Formula | C32H42N2O6 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | N-butyl-2-[2-[2-(butylamino)-2-oxoethyl]-4,5-dimethoxyphenyl]-6,7-dimethoxy-4-methylnaphthalene-1-carboxamide |
| SMILES | CCCCNC(=O)Cc1cc(OC)c(OC)cc1-c1cc(C)c2cc(OC)c(OC)cc2c1C(=O)NCCCC |
| InChI | InChI=1S/C32H42N2O6/c1-8-10-12-33-30(35)16-21-15-26(37-4)28(39-6)18-23(21)24-14-20(3)22-17-27(38-5)29(40-7)19-25(22)31(24)32(36)34-13-11-9-2/h14-15,17-19H,8-13,16H2,1-7H3,(H,33,35)(H,34,36) |
| InChIKey | SDGQOTNPVVQLSU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|