C21H26N+ — CID 53344319
(4R,7S)-10-methyl-1-(naphthalen-2-ylmethyl)-1-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 53344319) has the molecular formula C21H26N+ and a molecular weight of 292.45 g/mol. Its IUPAC name is (4R,7S)-10-methyl-1-(naphthalen-2-ylmethyl)-1-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | (4R,7S)-10-methyl-1-(naphthalen-2-ylmethyl)-1-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 53344319 |
| Molecular Formula | C21H26N+ |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | (4R,7S)-10-methyl-1-(naphthalen-2-ylmethyl)-1-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | CC12[C@@H]3CC[C@H]1CC[N+]2(Cc1ccc2ccccc2c1)CC3 |
| InChI | InChI=1S/C21H26N/c1-21-19-8-9-20(21)11-13-22(21,12-10-19)15-16-6-7-17-4-2-3-5-18(17)14-16/h2-7,14,19-20H,8-13,15H2,1H3/q+1/t19-,20+,21?,22? |
| InChIKey | OJYOLMCPJQSOCF-FDRBHKFBSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|