C29H34NO+ — CID 53341909
(1R,3S,4S,7S,8S,10R)-3,10-dimethyl-1-(naphthalen-2-ylmethyl)-8-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 53341909) has the molecular formula C29H34NO+ and a molecular weight of 412.60 g/mol. Its IUPAC name is (1R,3S,4S,7S,8S,10R)-3,10-dimethyl-1-(naphthalen-2-ylmethyl)-8-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | (1R,3S,4S,7S,8S,10R)-3,10-dimethyl-1-(naphthalen-2-ylmethyl)-8-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 53341909 |
| Molecular Formula | C29H34NO+ |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (1R,3S,4S,7S,8S,10R)-3,10-dimethyl-1-(naphthalen-2-ylmethyl)-8-phenylmethoxy-1-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | C[C@@H]1C[N@@+]2(Cc3ccc4ccccc4c3)C[C@@H](OCc3ccccc3)[C@H]3CC[C@@H]1[C@]32C |
| InChI | InChI=1S/C29H34NO/c1-21-17-30(18-23-12-13-24-10-6-7-11-25(24)16-23)19-28(27-15-14-26(21)29(27,30)2)31-20-22-8-4-3-5-9-22/h3-13,16,21,26-28H,14-15,17-20H2,1-2H3/q+1/t21-,26+,27-,28-,29-,30-/m1/s1 |
| InChIKey | YZWKBTYDHOWOGE-FIKZCNNCSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|