C21H32BrNO3 — CID 53343951
(1R,3R,4S,7S,10R)-1-benzyl-3-(2-methoxyethoxymethoxy)-10-methyl-1-azoniatricyclo[5.2.1.04,10]decane bromide (PubChem CID 53343951) has the molecular formula C21H32BrNO3 and a molecular weight of 426.40 g/mol. Its IUPAC name is (1R,3R,4S,7S,10R)-1-benzyl-3-(2-methoxyethoxymethoxy)-10-methyl-1-azoniatricyclo[5.2.1.04,10]decane bromide.
| Compound Name | (1R,3R,4S,7S,10R)-1-benzyl-3-(2-methoxyethoxymethoxy)-10-methyl-1-azoniatricyclo[5.2.1.04,10]decane bromide |
|---|---|
| PubChem CID | 53343951 |
| Molecular Formula | C21H32BrNO3 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (1R,3R,4S,7S,10R)-1-benzyl-3-(2-methoxyethoxymethoxy)-10-methyl-1-azoniatricyclo[5.2.1.04,10]decane bromide |
| SMILES | COCCOCO[C@H]1C[N@+]2(Cc3ccccc3)CC[C@@H]3CC[C@H]1[C@@]32C.[Br-] |
| InChI | InChI=1S/C21H32NO3.BrH/c1-21-18-8-9-19(21)20(25-16-24-13-12-23-2)15-22(21,11-10-18)14-17-6-4-3-5-7-17;/h3-7,18-20H,8-16H2,1-2H3;1H/q+1;/p-1/t18-,19+,20-,21+,22+;/m0./s1 |
| InChIKey | FGXMBAXVZRXDQY-HHTFQPSTSA-M |
| XLogP | 0.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|