C27H36NO+ — CID 53344327
(1R,3S,4S,7S,10R)-1-benzyl-10-methyl-3-phenylmethoxy-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane (PubChem CID 53344327) has the molecular formula C27H36NO+ and a molecular weight of 390.59 g/mol. Its IUPAC name is (1R,3S,4S,7S,10R)-1-benzyl-10-methyl-3-phenylmethoxy-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane.
| Compound Name | (1R,3S,4S,7S,10R)-1-benzyl-10-methyl-3-phenylmethoxy-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 53344327 |
| Molecular Formula | C27H36NO+ |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (1R,3S,4S,7S,10R)-1-benzyl-10-methyl-3-phenylmethoxy-3-propan-2-yl-1-azoniatricyclo[5.2.1.04,10]decane |
| SMILES | CC(C)[C@@]1(OCc2ccccc2)C[N@+]2(Cc3ccccc3)CC[C@@H]3CC[C@H]1[C@@]32C |
| InChI | InChI=1S/C27H36NO/c1-21(2)27(29-19-23-12-8-5-9-13-23)20-28(18-22-10-6-4-7-11-22)17-16-24-14-15-25(27)26(24,28)3/h4-13,21,24-25H,14-20H2,1-3H3/q+1/t24-,25-,26+,27-,28+/m0/s1 |
| InChIKey | XWLYZVUCSVNGJM-AJIIGFCHSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|