C15H15F3N4O2S — CID 53344437
N-methyl-2-[(2Z)-3-methyl-4-oxo-2-[(E)-[4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 53344437) has the molecular formula C15H15F3N4O2S and a molecular weight of 372.37 g/mol. Its IUPAC name is N-methyl-2-[(2Z)-3-methyl-4-oxo-2-[(E)-[4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-methyl-2-[(2Z)-3-methyl-4-oxo-2-[(E)-[4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 53344437 |
| Molecular Formula | C15H15F3N4O2S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-methyl-2-[(2Z)-3-methyl-4-oxo-2-[(E)-[4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CNC(=O)CC1S/C(=N\N=C\c2ccc(C(F)(F)F)cc2)N(C)C1=O |
| InChI | InChI=1S/C15H15F3N4O2S/c1-19-12(23)7-11-13(24)22(2)14(25-11)21-20-8-9-3-5-10(6-4-9)15(16,17)18/h3-6,8,11H,7H2,1-2H3,(H,19,23)/b20-8+,21-14- |
| InChIKey | QWHGSVBAYBZHES-NERNVWDPSA-N |
| XLogP | 2.11 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|