C32H37F8NO5 — CID 53345228
2-[(1R,3S,4R)-4-[(1-fluorocyclohexyl)methyl-[(2-fluoro-6-methoxyphenyl)methyl]amino]-3-[4-(trifluoromethyl)phenyl]cyclohexyl]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 53345228) has the molecular formula C32H37F8NO5 and a molecular weight of 667.63 g/mol. Its IUPAC name is 2-[(1R,3S,4R)-4-[(1-fluorocyclohexyl)methyl-[(2-fluoro-6-methoxyphenyl)methyl]amino]-3-[4-(trifluoromethyl)phenyl]cyclohexyl]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(1R,3S,4R)-4-[(1-fluorocyclohexyl)methyl-[(2-fluoro-6-methoxyphenyl)methyl]amino]-3-[4-(trifluoromethyl)phenyl]cyclohexyl]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53345228 |
| Molecular Formula | C32H37F8NO5 |
| Molecular Weight | 667.63 g/mol |
| Exact Mass | 667.25 |
| IUPAC Name | 2-[(1R,3S,4R)-4-[(1-fluorocyclohexyl)methyl-[(2-fluoro-6-methoxyphenyl)methyl]amino]-3-[4-(trifluoromethyl)phenyl]cyclohexyl]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(F)c1CN(CC1(F)CCCCC1)[C@@H]1CC[C@@H](CC(=O)O)C[C@H]1c1ccc(C(F)(F)F)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H36F5NO3.C2HF3O2/c1-39-27-7-5-6-25(31)24(27)18-36(19-29(32)14-3-2-4-15-29)26-13-8-20(17-28(37)38)16-23(26)21-9-11-22(12-10-21)30(33,34)35;3-2(4,5)1(6)7/h5-7,9-12,20,23,26H,2-4,8,13-19H2,1H3,(H,37,38);(H,6,7)/t20-,23+,26-;/m1./s1 |
| InChIKey | KSEIWGLIBFAHCM-APUHYXKOSA-N |
| XLogP | 8.39 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.63 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |