C15H22O10S2 — CID 53345736
[(7R,8R,9aS)-6,6,9a-trimethyl-3-oxo-7-sulfooxy-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-8-yl] hydrogen sulfate (PubChem CID 53345736) has the molecular formula C15H22O10S2 and a molecular weight of 426.47 g/mol. Its IUPAC name is [(7R,8R,9aS)-6,6,9a-trimethyl-3-oxo-7-sulfooxy-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-8-yl] hydrogen sulfate.
| Compound Name | [(7R,8R,9aS)-6,6,9a-trimethyl-3-oxo-7-sulfooxy-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-8-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 53345736 |
| Molecular Formula | C15H22O10S2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [(7R,8R,9aS)-6,6,9a-trimethyl-3-oxo-7-sulfooxy-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-8-yl] hydrogen sulfate |
| SMILES | CC1(C)C2CC=C3C(=O)OCC3[C@@]2(C)C[C@@H](OS(=O)(=O)O)[C@@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C15H22O10S2/c1-14(2)11-5-4-8-9(7-23-13(8)16)15(11,3)6-10(24-26(17,18)19)12(14)25-27(20,21)22/h4,9-12H,5-7H2,1-3H3,(H,17,18,19)(H,20,21,22)/t9?,10-,11?,12+,15-/m1/s1 |
| InChIKey | QUANKECDFDGNIN-FQXOEZIYSA-N |
| XLogP | 0.92 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|