C23H30O10 — CID 53345944
4-[[(7R,8R,9aS)-7-(3-carboxypropanoyloxy)-6,6,9a-trimethyl-3-oxo-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-8-yl]oxy]-4-oxobutanoic acid (PubChem CID 53345944) has the molecular formula C23H30O10 and a molecular weight of 466.48 g/mol. Its IUPAC name is 4-[[(7R,8R,9aS)-7-(3-carboxypropanoyloxy)-6,6,9a-trimethyl-3-oxo-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-8-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(7R,8R,9aS)-7-(3-carboxypropanoyloxy)-6,6,9a-trimethyl-3-oxo-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-8-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 53345944 |
| Molecular Formula | C23H30O10 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 4-[[(7R,8R,9aS)-7-(3-carboxypropanoyloxy)-6,6,9a-trimethyl-3-oxo-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-8-yl]oxy]-4-oxobutanoic acid |
| SMILES | CC1(C)C2CC=C3C(=O)OCC3[C@@]2(C)C[C@@H](OC(=O)CCC(=O)O)[C@@H]1OC(=O)CCC(=O)O |
| InChI | InChI=1S/C23H30O10/c1-22(2)15-5-4-12-13(11-31-21(12)30)23(15,3)10-14(32-18(28)8-6-16(24)25)20(22)33-19(29)9-7-17(26)27/h4,13-15,20H,5-11H2,1-3H3,(H,24,25)(H,26,27)/t13?,14-,15?,20+,23-/m1/s1 |
| InChIKey | NHNAQKZUAIFCKW-XHZHQHPVSA-N |
| XLogP | 2.10 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|