C25H28N2O2 — CID 53348386
(1R,13S,17S)-17-ethyl-16-[(1R)-2-hydroxy-1-phenylethyl]-9,16-diazatetracyclo[11.3.1.02,10.03,8]heptadeca-2(10),3,5,7-tetraen-15-one (PubChem CID 53348386) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (1R,13S,17S)-17-ethyl-16-[(1R)-2-hydroxy-1-phenylethyl]-9,16-diazatetracyclo[11.3.1.02,10.03,8]heptadeca-2(10),3,5,7-tetraen-15-one.
| Compound Name | (1R,13S,17S)-17-ethyl-16-[(1R)-2-hydroxy-1-phenylethyl]-9,16-diazatetracyclo[11.3.1.02,10.03,8]heptadeca-2(10),3,5,7-tetraen-15-one |
|---|---|
| PubChem CID | 53348386 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (1R,13S,17S)-17-ethyl-16-[(1R)-2-hydroxy-1-phenylethyl]-9,16-diazatetracyclo[11.3.1.02,10.03,8]heptadeca-2(10),3,5,7-tetraen-15-one |
| SMILES | CC[C@H]1[C@H]2CCc3[nH]c4ccccc4c3[C@@H]1N([C@@H](CO)c1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C25H28N2O2/c1-2-18-17-12-13-21-24(19-10-6-7-11-20(19)26-21)25(18)27(23(29)14-17)22(15-28)16-8-4-3-5-9-16/h3-11,17-18,22,25-26,28H,2,12-15H2,1H3/t17-,18-,22-,25+/m0/s1 |
| InChIKey | BQTJLEWJCXQKTL-ILGRESSZSA-N |
| XLogP | 4.76 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|