C13H15NO3 — CID 53348826
methyl (1S,6R)-6-(1H-pyrrole-2-carbonyl)cyclohex-3-ene-1-carboxylate (PubChem CID 53348826) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl (1S,6R)-6-(1H-pyrrole-2-carbonyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,6R)-6-(1H-pyrrole-2-carbonyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 53348826 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl (1S,6R)-6-(1H-pyrrole-2-carbonyl)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=CC[C@H]1C(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C13H15NO3/c1-17-13(16)10-6-3-2-5-9(10)12(15)11-7-4-8-14-11/h2-4,7-10,14H,5-6H2,1H3/t9-,10+/m1/s1 |
| InChIKey | OENFWQOCRXIYGG-ZJUUUORDSA-N |
| XLogP | 1.95 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|