C23H15Cl4NO5 — CID 53349370
4,5,6,7-tetrachloro-2-[2-[2-(3,4-dihydroxy-5-methoxyphenyl)ethyl]phenyl]isoindole-1,3-dione (PubChem CID 53349370) has the molecular formula C23H15Cl4NO5 and a molecular weight of 527.19 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[2-[2-(3,4-dihydroxy-5-methoxyphenyl)ethyl]phenyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[2-[2-(3,4-dihydroxy-5-methoxyphenyl)ethyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 53349370 |
| Molecular Formula | C23H15Cl4NO5 |
| Molecular Weight | 527.19 g/mol |
| Exact Mass | 524.97 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[2-[2-(3,4-dihydroxy-5-methoxyphenyl)ethyl]phenyl]isoindole-1,3-dione |
| SMILES | COc1cc(CCc2ccccc2N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cc(O)c1O |
| InChI | InChI=1S/C23H15Cl4NO5/c1-33-14-9-10(8-13(29)21(14)30)6-7-11-4-2-3-5-12(11)28-22(31)15-16(23(28)32)18(25)20(27)19(26)17(15)24/h2-5,8-9,29-30H,6-7H2,1H3 |
| InChIKey | WCAMYRMLZPIXOE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.19 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|