C9H14N2O2Se — CID 53360296
2-[2-(3,5-dimethylpyrazol-1-yl)ethylselanyl]acetic acid (PubChem CID 53360296) has the molecular formula C9H14N2O2Se and a molecular weight of 261.18 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpyrazol-1-yl)ethylselanyl]acetic acid.
| Compound Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethylselanyl]acetic acid |
|---|---|
| PubChem CID | 53360296 |
| Molecular Formula | C9H14N2O2Se |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethylselanyl]acetic acid |
| SMILES | Cc1cc(C)n(CC[Se]CC(=O)O)n1 |
| InChI | InChI=1S/C9H14N2O2Se/c1-7-5-8(2)11(10-7)3-4-14-6-9(12)13/h5H,3-4,6H2,1-2H3,(H,12,13) |
| InChIKey | SSIAIQSLMSEULH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|