C21H22ClN2O2 — CID 53360581
CID 53360581 (PubChem CID 53360581) has the molecular formula C21H22ClN2O2 and a molecular weight of 369.87 g/mol.
| Compound Name | CID 53360581 |
|---|---|
| PubChem CID | 53360581 |
| Molecular Formula | C21H22ClN2O2 |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | — |
| SMILES | CC(CNc1ccnc2cc(Cl)ccc12)OC(=O)CCC[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C21H22ClN2O2/c1-15(26-21(25)8-4-7-16-5-2-3-6-16)14-24-19-11-12-23-20-13-17(22)9-10-18(19)20/h2-3,5-6,9-13,15H,4,7-8,14H2,1H3,(H,23,24) |
| InChIKey | HKUMVEQPQCCSSK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |