About CID 53360585
CID 53360585 (PubChem CID 53360585) has the molecular formula C22H24ClN2O2
and a molecular weight of 383.90 g/mol.
Molecular Properties
| Compound Name | CID 53360585 |
| PubChem CID | 53360585 |
| Molecular Formula | C22H24ClN2O2 |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | — |
| SMILES | CCC(CNc1ccnc2cc(Cl)ccc12)OC(=O)CCC[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C22H24ClN2O2/c1-2-18(27-22(26)9-5-8-16-6-3-4-7-16)15-25-20-12-13-24-21-14-17(23)10-11-19(20)21/h3-4,6-7,10-14,18H,2,5,8-9,15H2,1H3,(H,24,25) |
| InChIKey | VPSFQNQMTRWBJG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 53360585 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53360585?
The IUPAC name of CID 53360585 (CID 53360585) is not available.
What is the SMILES notation for CID 53360585?
The canonical SMILES for CID 53360585 is CCC(CNc1ccnc2cc(Cl)ccc12)OC(=O)CCC[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 53360585?
The InChIKey is VPSFQNQMTRWBJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24ClN2O2/c1-2-18(27-22(26)9-5-8-16-6-3-4-7-16)15-25-20-12-13-24-21-14-17(23)10-11-19(20)21/h3-4,6-7,10-14,18H,2,5,8-9,15H2,1H3,(H,24,25).
What are the key properties of CID 53360585?
CID 53360585 has a molecular weight of 383.90 g/mol, XLogP of 5.20, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53360585 is sourced from PubChem (CID 53360585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).