C22H24ClN2O2 — CID 53360585
CID 53360585 (PubChem CID 53360585) has the molecular formula C22H24ClN2O2 and a molecular weight of 383.90 g/mol.
| Compound Name | CID 53360585 |
|---|---|
| PubChem CID | 53360585 |
| Molecular Formula | C22H24ClN2O2 |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | — |
| SMILES | CCC(CNc1ccnc2cc(Cl)ccc12)OC(=O)CCC[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C22H24ClN2O2/c1-2-18(27-22(26)9-5-8-16-6-3-4-7-16)15-25-20-12-13-24-21-14-17(23)10-11-19(20)21/h3-4,6-7,10-14,18H,2,5,8-9,15H2,1H3,(H,24,25) |
| InChIKey | VPSFQNQMTRWBJG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |