C25H24O8 — CID 53361356
(E)-3-[3-[(3,4-dihydroxyphenyl)methyl]-6-hydroxy-2,4-dimethoxyphenyl]-1-(3-hydroxy-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 53361356) has the molecular formula C25H24O8 and a molecular weight of 452.46 g/mol. Its IUPAC name is (E)-3-[3-[(3,4-dihydroxyphenyl)methyl]-6-hydroxy-2,4-dimethoxyphenyl]-1-(3-hydroxy-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(3,4-dihydroxyphenyl)methyl]-6-hydroxy-2,4-dimethoxyphenyl]-1-(3-hydroxy-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 53361356 |
| Molecular Formula | C25H24O8 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (E)-3-[3-[(3,4-dihydroxyphenyl)methyl]-6-hydroxy-2,4-dimethoxyphenyl]-1-(3-hydroxy-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2c(O)cc(OC)c(Cc3ccc(O)c(O)c3)c2OC)cc1O |
| InChI | InChI=1S/C25H24O8/c1-31-23-9-5-15(12-22(23)30)18(26)8-6-16-20(28)13-24(32-2)17(25(16)33-3)10-14-4-7-19(27)21(29)11-14/h4-9,11-13,27-30H,10H2,1-3H3/b8-6+ |
| InChIKey | DRHHMLLFTQIHIJ-SOFGYWHQSA-N |
| XLogP | 4.02 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|