C10H18O6 — CID 53362330
[(2R,3S,4R)-3,4-bis(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methanol (PubChem CID 53362330) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-bis(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methanol.
| Compound Name | [(2R,3S,4R)-3,4-bis(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methanol |
|---|---|
| PubChem CID | 53362330 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [(2R,3S,4R)-3,4-bis(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methanol |
| SMILES | COCO[C@H]1[C@H](OCOC)C=CO[C@@H]1CO |
| InChI | InChI=1S/C10H18O6/c1-12-6-15-8-3-4-14-9(5-11)10(8)16-7-13-2/h3-4,8-11H,5-7H2,1-2H3/t8-,9-,10+/m1/s1 |
| InChIKey | MUCRONSHSADEGB-BBBLOLIVSA-N |
| XLogP | -0.13 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|