C19H26N4O2 — CID 53370533
N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N'-(1-phenylethyl)oxamide (PubChem CID 53370533) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N'-(1-phenylethyl)oxamide.
| Compound Name | N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N'-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 53370533 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N'-(1-phenylethyl)oxamide |
| SMILES | Cc1nn(CC(C)C)c(C)c1NC(=O)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C19H26N4O2/c1-12(2)11-23-15(5)17(14(4)22-23)21-19(25)18(24)20-13(3)16-9-7-6-8-10-16/h6-10,12-13H,11H2,1-5H3,(H,20,24)(H,21,25) |
| InChIKey | ZEKXRMRZBUVLJS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|