C17H22N4O3 — CID 51819593
N'-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2S)-2-hydroxypropyl]oxamide (PubChem CID 51819593) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is N'-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2S)-2-hydroxypropyl]oxamide.
| Compound Name | N'-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2S)-2-hydroxypropyl]oxamide |
|---|---|
| PubChem CID | 51819593 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N'-(1-benzyl-3,5-dimethylpyrazol-4-yl)-N-[(2S)-2-hydroxypropyl]oxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=O)C(=O)NC[C@H](C)O |
| InChI | InChI=1S/C17H22N4O3/c1-11(22)9-18-16(23)17(24)19-15-12(2)20-21(13(15)3)10-14-7-5-4-6-8-14/h4-8,11,22H,9-10H2,1-3H3,(H,18,23)(H,19,24)/t11-/m0/s1 |
| InChIKey | GMTZZXZBBFVOPG-NSHDSACASA-N |
| XLogP | 0.98 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|