C20H17BrN2O2S — CID 53373330
2-[2-[(4-bromophenyl)methyl]-1-sulfanylidene-3,4-dihydropyrido[3,4-b]indol-9-yl]acetic acid (PubChem CID 53373330) has the molecular formula C20H17BrN2O2S and a molecular weight of 429.34 g/mol. Its IUPAC name is 2-[2-[(4-bromophenyl)methyl]-1-sulfanylidene-3,4-dihydropyrido[3,4-b]indol-9-yl]acetic acid.
| Compound Name | 2-[2-[(4-bromophenyl)methyl]-1-sulfanylidene-3,4-dihydropyrido[3,4-b]indol-9-yl]acetic acid |
|---|---|
| PubChem CID | 53373330 |
| Molecular Formula | C20H17BrN2O2S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 2-[2-[(4-bromophenyl)methyl]-1-sulfanylidene-3,4-dihydropyrido[3,4-b]indol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3ccccc31)CCN(Cc1ccc(Br)cc1)C2=S |
| InChI | InChI=1S/C20H17BrN2O2S/c21-14-7-5-13(6-8-14)11-22-10-9-16-15-3-1-2-4-17(15)23(12-18(24)25)19(16)20(22)26/h1-8H,9-12H2,(H,24,25) |
| InChIKey | NCOJBOIGJDFUFH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|