C15H13ClF3N3O3S — CID 53374051
5-[1-[[2-chloro-4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]-N-hydroxythiophene-2-carboxamide (PubChem CID 53374051) has the molecular formula C15H13ClF3N3O3S and a molecular weight of 407.80 g/mol. Its IUPAC name is 5-[1-[[2-chloro-4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]-N-hydroxythiophene-2-carboxamide.
| Compound Name | 5-[1-[[2-chloro-4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]-N-hydroxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 53374051 |
| Molecular Formula | C15H13ClF3N3O3S |
| Molecular Weight | 407.80 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 5-[1-[[2-chloro-4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]-N-hydroxythiophene-2-carboxamide |
| SMILES | CC(NC(=O)Nc1ccc(C(F)(F)F)cc1Cl)c1ccc(C(=O)NO)s1 |
| InChI | InChI=1S/C15H13ClF3N3O3S/c1-7(11-4-5-12(26-11)13(23)22-25)20-14(24)21-10-3-2-8(6-9(10)16)15(17,18)19/h2-7,25H,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | QHQAETRWOFRPFF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|