C15H16ClN3O3S — CID 58418295
5-[1-[(4-chloro-3-methylphenyl)carbamoylamino]ethyl]-N-hydroxythiophene-2-carboxamide (PubChem CID 58418295) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 5-[1-[(4-chloro-3-methylphenyl)carbamoylamino]ethyl]-N-hydroxythiophene-2-carboxamide.
| Compound Name | 5-[1-[(4-chloro-3-methylphenyl)carbamoylamino]ethyl]-N-hydroxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 58418295 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 5-[1-[(4-chloro-3-methylphenyl)carbamoylamino]ethyl]-N-hydroxythiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)NC(C)c2ccc(C(=O)NO)s2)ccc1Cl |
| InChI | InChI=1S/C15H16ClN3O3S/c1-8-7-10(3-4-11(8)16)18-15(21)17-9(2)12-5-6-13(23-12)14(20)19-22/h3-7,9,22H,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | PHAWUZSCGLOIGB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|