C20H27NO2 — CID 53376214
(3S,4R)-4-ethyl-N-(furan-2-ylmethyl)-6-phenylmethoxyhex-1-en-3-amine (PubChem CID 53376214) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (3S,4R)-4-ethyl-N-(furan-2-ylmethyl)-6-phenylmethoxyhex-1-en-3-amine.
| Compound Name | (3S,4R)-4-ethyl-N-(furan-2-ylmethyl)-6-phenylmethoxyhex-1-en-3-amine |
|---|---|
| PubChem CID | 53376214 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (3S,4R)-4-ethyl-N-(furan-2-ylmethyl)-6-phenylmethoxyhex-1-en-3-amine |
| SMILES | C=C[C@H](NCc1ccco1)C(CC)CCOCc1ccccc1 |
| InChI | InChI=1S/C20H27NO2/c1-3-18(12-14-22-16-17-9-6-5-7-10-17)20(4-2)21-15-19-11-8-13-23-19/h4-11,13,18,20-21H,2-3,12,14-16H2,1H3/t18?,20-/m0/s1 |
| InChIKey | RCTAUQNBZLENJB-IJHRGXPZSA-N |
| XLogP | 4.56 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|